C21H26N4O6S — CID 41197745
(5R)-3-[2-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-5-cyclopropyl-5-methylimidazolidine-2,4-dione (PubChem CID 41197745) has the molecular formula C21H26N4O6S and a molecular weight of 462.53 g/mol. Its IUPAC name is (5R)-3-[2-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-5-cyclopropyl-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[2-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-5-cyclopropyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41197745 |
| Molecular Formula | C21H26N4O6S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | (5R)-3-[2-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-5-cyclopropyl-5-methylimidazolidine-2,4-dione |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)CN3C(=O)N[C@](C)(C4CC4)C3=O)CC2)cc1 |
| InChI | InChI=1S/C21H26N4O6S/c1-14(26)15-3-7-17(8-4-15)32(30,31)24-11-9-23(10-12-24)18(27)13-25-19(28)21(2,16-5-6-16)22-20(25)29/h3-4,7-8,16H,5-6,9-13H2,1-2H3,(H,22,29)/t21-/m1/s1 |
| InChIKey | NCUQNZBPZMYVEL-OAQYLSRUSA-N |
| XLogP | 0.44 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|