C18H22Cl2N4O4S — CID 31325392
(5R)-5-cyclopropyl-3-[[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 31325392) has the molecular formula C18H22Cl2N4O4S and a molecular weight of 461.37 g/mol. Its IUPAC name is (5R)-5-cyclopropyl-3-[[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-cyclopropyl-3-[[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 31325392 |
| Molecular Formula | C18H22Cl2N4O4S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | (5R)-5-cyclopropyl-3-[[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(C2CC2)NC(=O)N(CN2CCN(S(=O)(=O)c3cccc(Cl)c3Cl)CC2)C1=O |
| InChI | InChI=1S/C18H22Cl2N4O4S/c1-18(12-5-6-12)16(25)24(17(26)21-18)11-22-7-9-23(10-8-22)29(27,28)14-4-2-3-13(19)15(14)20/h2-4,12H,5-11H2,1H3,(H,21,26)/t18-/m1/s1 |
| InChIKey | SDKHNZPOGKFDCU-GOSISDBHSA-N |
| XLogP | 1.98 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|