C20H28N4O6S — CID 31325374
(5S)-5-cyclopropyl-3-[[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 31325374) has the molecular formula C20H28N4O6S and a molecular weight of 452.53 g/mol. Its IUPAC name is (5S)-5-cyclopropyl-3-[[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-cyclopropyl-3-[[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 31325374 |
| Molecular Formula | C20H28N4O6S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | (5S)-5-cyclopropyl-3-[[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCN(CN3C(=O)N[C@@](C)(C4CC4)C3=O)CC2)c1 |
| InChI | InChI=1S/C20H28N4O6S/c1-20(14-4-5-14)18(25)24(19(26)21-20)13-22-8-10-23(11-9-22)31(27,28)17-12-15(29-2)6-7-16(17)30-3/h6-7,12,14H,4-5,8-11,13H2,1-3H3,(H,21,26)/t20-/m0/s1 |
| InChIKey | XQGUWZHGMDBBTN-FQEVSTJZSA-N |
| XLogP | 0.69 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|