C17H26N2O4S — CID 120714214
1-(2,5-dimethoxyphenyl)sulfonyl-4-pyrrolidin-2-ylpiperidine (PubChem CID 120714214) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)sulfonyl-4-pyrrolidin-2-ylpiperidine.
| Compound Name | 1-(2,5-dimethoxyphenyl)sulfonyl-4-pyrrolidin-2-ylpiperidine |
|---|---|
| PubChem CID | 120714214 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)sulfonyl-4-pyrrolidin-2-ylpiperidine |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCC(C3CCCN3)CC2)c1 |
| InChI | InChI=1S/C17H26N2O4S/c1-22-14-5-6-16(23-2)17(12-14)24(20,21)19-10-7-13(8-11-19)15-4-3-9-18-15/h5-6,12-13,15,18H,3-4,7-11H2,1-2H3 |
| InChIKey | CRTNWRVGRPYFPJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |