C16H25ClN2O3S — CID 120714166
1-(2-methoxyphenyl)sulfonyl-4-pyrrolidin-2-ylpiperidine;hydrochloride (PubChem CID 120714166) has the molecular formula C16H25ClN2O3S and a molecular weight of 360.91 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)sulfonyl-4-pyrrolidin-2-ylpiperidine;hydrochloride.
| Compound Name | 1-(2-methoxyphenyl)sulfonyl-4-pyrrolidin-2-ylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 120714166 |
| Molecular Formula | C16H25ClN2O3S |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-(2-methoxyphenyl)sulfonyl-4-pyrrolidin-2-ylpiperidine;hydrochloride |
| SMILES | COc1ccccc1S(=O)(=O)N1CCC(C2CCCN2)CC1.Cl |
| InChI | InChI=1S/C16H24N2O3S.ClH/c1-21-15-6-2-3-7-16(15)22(19,20)18-11-8-13(9-12-18)14-5-4-10-17-14;/h2-3,6-7,13-14,17H,4-5,8-12H2,1H3;1H |
| InChIKey | AFKHSRMARFVOOB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |