C19H23NO4S2 — CID 90629604
4-(2,5-dimethoxyphenyl)sulfonyl-7-phenyl-1,4-thiazepane (PubChem CID 90629604) has the molecular formula C19H23NO4S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)sulfonyl-7-phenyl-1,4-thiazepane.
| Compound Name | 4-(2,5-dimethoxyphenyl)sulfonyl-7-phenyl-1,4-thiazepane |
|---|---|
| PubChem CID | 90629604 |
| Molecular Formula | C19H23NO4S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)sulfonyl-7-phenyl-1,4-thiazepane |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCSC(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C19H23NO4S2/c1-23-16-8-9-17(24-2)19(14-16)26(21,22)20-11-10-18(25-13-12-20)15-6-4-3-5-7-15/h3-9,14,18H,10-13H2,1-2H3 |
| InChIKey | UJTFLONMLRZGEW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |