C20H25NO3S2 — CID 90629655
4-(4-ethoxy-3-methylphenyl)sulfonyl-7-phenyl-1,4-thiazepane (PubChem CID 90629655) has the molecular formula C20H25NO3S2 and a molecular weight of 391.56 g/mol. Its IUPAC name is 4-(4-ethoxy-3-methylphenyl)sulfonyl-7-phenyl-1,4-thiazepane.
| Compound Name | 4-(4-ethoxy-3-methylphenyl)sulfonyl-7-phenyl-1,4-thiazepane |
|---|---|
| PubChem CID | 90629655 |
| Molecular Formula | C20H25NO3S2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 4-(4-ethoxy-3-methylphenyl)sulfonyl-7-phenyl-1,4-thiazepane |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCSC(c3ccccc3)CC2)cc1C |
| InChI | InChI=1S/C20H25NO3S2/c1-3-24-19-10-9-18(15-16(19)2)26(22,23)21-12-11-20(25-14-13-21)17-7-5-4-6-8-17/h4-10,15,20H,3,11-14H2,1-2H3 |
| InChIKey | IAHWRSXCAKZRBH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |