About 4-(4-chlorophenyl)sulfonyl-7-phenyl-1,4-thiazepane
4-(4-chlorophenyl)sulfonyl-7-phenyl-1,4-thiazepane (PubChem CID 90629597) has the molecular formula C17H18ClNO2S2
and a molecular weight of 367.92 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfonyl-7-phenyl-1,4-thiazepane.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)sulfonyl-7-phenyl-1,4-thiazepane |
| PubChem CID | 90629597 |
| Molecular Formula | C17H18ClNO2S2 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 4-(4-chlorophenyl)sulfonyl-7-phenyl-1,4-thiazepane |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCSC(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H18ClNO2S2/c18-15-6-8-16(9-7-15)23(20,21)19-11-10-17(22-13-12-19)14-4-2-1-3-5-14/h1-9,17H,10-13H2 |
| InChIKey | VBHVCGSEFGIXOR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-chlorophenyl)sulfonyl-7-phenyl-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)sulfonyl-7-phenyl-1,4-thiazepane?
The IUPAC name of 4-(4-chlorophenyl)sulfonyl-7-phenyl-1,4-thiazepane (CID 90629597) is 4-(4-chlorophenyl)sulfonyl-7-phenyl-1,4-thiazepane.
What is the SMILES notation for 4-(4-chlorophenyl)sulfonyl-7-phenyl-1,4-thiazepane?
The canonical SMILES for 4-(4-chlorophenyl)sulfonyl-7-phenyl-1,4-thiazepane is O=S(=O)(c1ccc(Cl)cc1)N1CCSC(c2ccccc2)CC1.
What is the InChIKey of 4-(4-chlorophenyl)sulfonyl-7-phenyl-1,4-thiazepane?
The InChIKey is VBHVCGSEFGIXOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClNO2S2/c18-15-6-8-16(9-7-15)23(20,21)19-11-10-17(22-13-12-19)14-4-2-1-3-5-14/h1-9,17H,10-13H2.
What are the key properties of 4-(4-chlorophenyl)sulfonyl-7-phenyl-1,4-thiazepane?
4-(4-chlorophenyl)sulfonyl-7-phenyl-1,4-thiazepane has a molecular weight of 367.92 g/mol, XLogP of 4.21, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)sulfonyl-7-phenyl-1,4-thiazepane is sourced from PubChem (CID 90629597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).