C18H18F3NO3S2 — CID 73169058
7-phenyl-4-[2-(trifluoromethoxy)phenyl]sulfonyl-1,4-thiazepane (PubChem CID 73169058) has the molecular formula C18H18F3NO3S2 and a molecular weight of 417.47 g/mol. Its IUPAC name is 7-phenyl-4-[2-(trifluoromethoxy)phenyl]sulfonyl-1,4-thiazepane.
| Compound Name | 7-phenyl-4-[2-(trifluoromethoxy)phenyl]sulfonyl-1,4-thiazepane |
|---|---|
| PubChem CID | 73169058 |
| Molecular Formula | C18H18F3NO3S2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 7-phenyl-4-[2-(trifluoromethoxy)phenyl]sulfonyl-1,4-thiazepane |
| SMILES | O=S(=O)(c1ccccc1OC(F)(F)F)N1CCSC(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H18F3NO3S2/c19-18(20,21)25-15-8-4-5-9-17(15)27(23,24)22-11-10-16(26-13-12-22)14-6-2-1-3-7-14/h1-9,16H,10-13H2 |
| InChIKey | PFVOLLBDLRFFJK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |