C15H21F3N2O4S — CID 119992802
3-[1-[2-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]oxypropan-1-amine (PubChem CID 119992802) has the molecular formula C15H21F3N2O4S and a molecular weight of 382.40 g/mol. Its IUPAC name is 3-[1-[2-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]oxypropan-1-amine.
| Compound Name | 3-[1-[2-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 119992802 |
| Molecular Formula | C15H21F3N2O4S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 3-[1-[2-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]oxypropan-1-amine |
| SMILES | NCCCOC1CCN(S(=O)(=O)c2ccccc2OC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H21F3N2O4S/c16-15(17,18)24-13-4-1-2-5-14(13)25(21,22)20-9-6-12(7-10-20)23-11-3-8-19/h1-2,4-5,12H,3,6-11,19H2 |
| InChIKey | KITCPWJCRQGRDT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|