C15H22ClF3N2O3S2 — CID 119992881
3-[1-[4-(trifluoromethylsulfanyl)phenyl]sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride (PubChem CID 119992881) has the molecular formula C15H22ClF3N2O3S2 and a molecular weight of 434.93 g/mol. Its IUPAC name is 3-[1-[4-(trifluoromethylsulfanyl)phenyl]sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride.
| Compound Name | 3-[1-[4-(trifluoromethylsulfanyl)phenyl]sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 119992881 |
| Molecular Formula | C15H22ClF3N2O3S2 |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 3-[1-[4-(trifluoromethylsulfanyl)phenyl]sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(S(=O)(=O)c2ccc(SC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H21F3N2O3S2.ClH/c16-15(17,18)24-13-2-4-14(5-3-13)25(21,22)20-9-6-12(7-10-20)23-11-1-8-19;/h2-5,12H,1,6-11,19H2;1H |
| InChIKey | PIGSBKFYFHEQKZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|