C19H32ClN3O4S — CID 119992821
4-[4-(3-aminopropoxy)piperidin-1-yl]sulfonyl-N,N-diethylbenzamide;hydrochloride (PubChem CID 119992821) has the molecular formula C19H32ClN3O4S and a molecular weight of 434.00 g/mol. Its IUPAC name is 4-[4-(3-aminopropoxy)piperidin-1-yl]sulfonyl-N,N-diethylbenzamide;hydrochloride.
| Compound Name | 4-[4-(3-aminopropoxy)piperidin-1-yl]sulfonyl-N,N-diethylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119992821 |
| Molecular Formula | C19H32ClN3O4S |
| Molecular Weight | 434.00 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 4-[4-(3-aminopropoxy)piperidin-1-yl]sulfonyl-N,N-diethylbenzamide;hydrochloride |
| SMILES | CCN(CC)C(=O)c1ccc(S(=O)(=O)N2CCC(OCCCN)CC2)cc1.Cl |
| InChI | InChI=1S/C19H31N3O4S.ClH/c1-3-21(4-2)19(23)16-6-8-18(9-7-16)27(24,25)22-13-10-17(11-14-22)26-15-5-12-20;/h6-9,17H,3-5,10-15,20H2,1-2H3;1H |
| InChIKey | UNHXNTYOSCEFHQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.00 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|