C17H21NO4S3 — CID 90633037
4-(2,5-dimethoxyphenyl)sulfonyl-7-thiophen-2-yl-1,4-thiazepane (PubChem CID 90633037) has the molecular formula C17H21NO4S3 and a molecular weight of 399.56 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)sulfonyl-7-thiophen-2-yl-1,4-thiazepane.
| Compound Name | 4-(2,5-dimethoxyphenyl)sulfonyl-7-thiophen-2-yl-1,4-thiazepane |
|---|---|
| PubChem CID | 90633037 |
| Molecular Formula | C17H21NO4S3 |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)sulfonyl-7-thiophen-2-yl-1,4-thiazepane |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCSC(c3cccs3)CC2)c1 |
| InChI | InChI=1S/C17H21NO4S3/c1-21-13-5-6-14(22-2)17(12-13)25(19,20)18-8-7-16(24-11-9-18)15-4-3-10-23-15/h3-6,10,12,16H,7-9,11H2,1-2H3 |
| InChIKey | XMOQAGTZOFEUJB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |