C18H24N2O4S2 — CID 3836701
1-(2,5-dimethoxyphenyl)sulfonyl-4-(2-thiophen-2-ylethyl)piperazine (PubChem CID 3836701) has the molecular formula C18H24N2O4S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)sulfonyl-4-(2-thiophen-2-ylethyl)piperazine.
| Compound Name | 1-(2,5-dimethoxyphenyl)sulfonyl-4-(2-thiophen-2-ylethyl)piperazine |
|---|---|
| PubChem CID | 3836701 |
| Molecular Formula | C18H24N2O4S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)sulfonyl-4-(2-thiophen-2-ylethyl)piperazine |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCN(CCc3cccs3)CC2)c1 |
| InChI | InChI=1S/C18H24N2O4S2/c1-23-15-5-6-17(24-2)18(14-15)26(21,22)20-11-9-19(10-12-20)8-7-16-4-3-13-25-16/h3-6,13-14H,7-12H2,1-2H3 |
| InChIKey | OAMWQPDEGBXTIW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |