C12H17NO6S2 — CID 110721462
4-(2,5-dimethoxyphenyl)sulfonyl-1,4-thiazinane 1,1-dioxide (PubChem CID 110721462) has the molecular formula C12H17NO6S2 and a molecular weight of 335.40 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)sulfonyl-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(2,5-dimethoxyphenyl)sulfonyl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 110721462 |
| Molecular Formula | C12H17NO6S2 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)sulfonyl-1,4-thiazinane 1,1-dioxide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C12H17NO6S2/c1-18-10-3-4-11(19-2)12(9-10)21(16,17)13-5-7-20(14,15)8-6-13/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | RUONSYPSMWAUDL-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |