C12H17NO5S — CID 110739698
3-(2,5-dimethoxyphenyl)sulfonyl-1,3-oxazinane (PubChem CID 110739698) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)sulfonyl-1,3-oxazinane.
| Compound Name | 3-(2,5-dimethoxyphenyl)sulfonyl-1,3-oxazinane |
|---|---|
| PubChem CID | 110739698 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)sulfonyl-1,3-oxazinane |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCCOC2)c1 |
| InChI | InChI=1S/C12H17NO5S/c1-16-10-4-5-11(17-2)12(8-10)19(14,15)13-6-3-7-18-9-13/h4-5,8H,3,6-7,9H2,1-2H3 |
| InChIKey | MCEYKQPFLNPOMQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |