C10H12ClNO4S — CID 110740103
3-(5-chloro-2-methoxyphenyl)sulfonyl-1,3-oxazolidine (PubChem CID 110740103) has the molecular formula C10H12ClNO4S and a molecular weight of 277.73 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyphenyl)sulfonyl-1,3-oxazolidine.
| Compound Name | 3-(5-chloro-2-methoxyphenyl)sulfonyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 110740103 |
| Molecular Formula | C10H12ClNO4S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 3-(5-chloro-2-methoxyphenyl)sulfonyl-1,3-oxazolidine |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N1CCOC1 |
| InChI | InChI=1S/C10H12ClNO4S/c1-15-9-3-2-8(11)6-10(9)17(13,14)12-4-5-16-7-12/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | WNKYGSLHYGWAQF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |