C12H16ClNO5S — CID 760766
4-(4-chloro-2,5-dimethoxyphenyl)sulfonylmorpholine (PubChem CID 760766) has the molecular formula C12H16ClNO5S and a molecular weight of 321.78 g/mol. Its IUPAC name is 4-(4-chloro-2,5-dimethoxyphenyl)sulfonylmorpholine.
| Compound Name | 4-(4-chloro-2,5-dimethoxyphenyl)sulfonylmorpholine |
|---|---|
| PubChem CID | 760766 |
| Molecular Formula | C12H16ClNO5S |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 4-(4-chloro-2,5-dimethoxyphenyl)sulfonylmorpholine |
| SMILES | COc1cc(S(=O)(=O)N2CCOCC2)c(OC)cc1Cl |
| InChI | InChI=1S/C12H16ClNO5S/c1-17-10-8-12(11(18-2)7-9(10)13)20(15,16)14-3-5-19-6-4-14/h7-8H,3-6H2,1-2H3 |
| InChIKey | FOYGFQPJVDAFGL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |