C11H13Cl2NO4S — CID 110758541
4-(3,5-dichloro-2-methoxyphenyl)sulfonylmorpholine (PubChem CID 110758541) has the molecular formula C11H13Cl2NO4S and a molecular weight of 326.20 g/mol. Its IUPAC name is 4-(3,5-dichloro-2-methoxyphenyl)sulfonylmorpholine.
| Compound Name | 4-(3,5-dichloro-2-methoxyphenyl)sulfonylmorpholine |
|---|---|
| PubChem CID | 110758541 |
| Molecular Formula | C11H13Cl2NO4S |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 4-(3,5-dichloro-2-methoxyphenyl)sulfonylmorpholine |
| SMILES | COc1c(Cl)cc(Cl)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C11H13Cl2NO4S/c1-17-11-9(13)6-8(12)7-10(11)19(15,16)14-2-4-18-5-3-14/h6-7H,2-5H2,1H3 |
| InChIKey | SFLOJUFKAPINKB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |