C15H21NO7S — CID 118477196
1-(2,3,4-trimethoxy-5-morpholin-4-ylsulfonylphenyl)ethanone (PubChem CID 118477196) has the molecular formula C15H21NO7S and a molecular weight of 359.40 g/mol. Its IUPAC name is 1-(2,3,4-trimethoxy-5-morpholin-4-ylsulfonylphenyl)ethanone.
| Compound Name | 1-(2,3,4-trimethoxy-5-morpholin-4-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 118477196 |
| Molecular Formula | C15H21NO7S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 1-(2,3,4-trimethoxy-5-morpholin-4-ylsulfonylphenyl)ethanone |
| SMILES | COc1c(C(C)=O)cc(S(=O)(=O)N2CCOCC2)c(OC)c1OC |
| InChI | InChI=1S/C15H21NO7S/c1-10(17)11-9-12(14(21-3)15(22-4)13(11)20-2)24(18,19)16-5-7-23-8-6-16/h9H,5-8H2,1-4H3 |
| InChIKey | WYYWGFWNYBLBBB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |