C11H11F4NO4S — CID 18191807
4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)sulfonylmorpholine (PubChem CID 18191807) has the molecular formula C11H11F4NO4S and a molecular weight of 329.27 g/mol. Its IUPAC name is 4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)sulfonylmorpholine.
| Compound Name | 4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)sulfonylmorpholine |
|---|---|
| PubChem CID | 18191807 |
| Molecular Formula | C11H11F4NO4S |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)sulfonylmorpholine |
| SMILES | COc1c(F)c(F)c(S(=O)(=O)N2CCOCC2)c(F)c1F |
| InChI | InChI=1S/C11H11F4NO4S/c1-19-10-6(12)8(14)11(9(15)7(10)13)21(17,18)16-2-4-20-5-3-16/h2-5H2,1H3 |
| InChIKey | QXWWZCYWZOPOKG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|