C9H6F5NO2S — CID 153301466
1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine (PubChem CID 153301466) has the molecular formula C9H6F5NO2S and a molecular weight of 287.21 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine |
|---|---|
| PubChem CID | 153301466 |
| Molecular Formula | C9H6F5NO2S |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine |
| SMILES | O=S(=O)(c1c(F)c(F)c(F)c(F)c1F)N1CCC1 |
| InChI | InChI=1S/C9H6F5NO2S/c10-4-5(11)7(13)9(8(14)6(4)12)18(16,17)15-2-1-3-15/h1-3H2 |
| InChIKey | CHWSWGZZVQASHI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|