C18H17F4NO5S2 — CID 21138806
4-(4-benzylpiperidin-1-yl)sulfonyl-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 21138806) has the molecular formula C18H17F4NO5S2 and a molecular weight of 467.46 g/mol. Its IUPAC name is 4-(4-benzylpiperidin-1-yl)sulfonyl-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-(4-benzylpiperidin-1-yl)sulfonyl-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 21138806 |
| Molecular Formula | C18H17F4NO5S2 |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 4-(4-benzylpiperidin-1-yl)sulfonyl-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1c(F)c(F)c(S(=O)(=O)N2CCC(Cc3ccccc3)CC2)c(F)c1F |
| InChI | InChI=1S/C18H17F4NO5S2/c19-13-15(21)18(30(26,27)28)16(22)14(20)17(13)29(24,25)23-8-6-12(7-9-23)10-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,26,27,28) |
| InChIKey | WUPCZJJDUXLMDO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|