C19H16ClF4NO3S — CID 21138810
4-(4-benzylpiperidine-1-carbonyl)-2,3,5,6-tetrafluorobenzenesulfonyl chloride (PubChem CID 21138810) has the molecular formula C19H16ClF4NO3S and a molecular weight of 449.85 g/mol. Its IUPAC name is 4-(4-benzylpiperidine-1-carbonyl)-2,3,5,6-tetrafluorobenzenesulfonyl chloride.
| Compound Name | 4-(4-benzylpiperidine-1-carbonyl)-2,3,5,6-tetrafluorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 21138810 |
| Molecular Formula | C19H16ClF4NO3S |
| Molecular Weight | 449.85 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 4-(4-benzylpiperidine-1-carbonyl)-2,3,5,6-tetrafluorobenzenesulfonyl chloride |
| SMILES | O=C(c1c(F)c(F)c(S(=O)(=O)Cl)c(F)c1F)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H16ClF4NO3S/c20-29(27,28)18-16(23)14(21)13(15(22)17(18)24)19(26)25-8-6-12(7-9-25)10-11-4-2-1-3-5-11/h1-5,12H,6-10H2 |
| InChIKey | IZCAFUWBFXYQNP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.85 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|