C21H25F4NO2S — CID 159975613
(4-benzylpiperidin-1-yl)-(2,3,5,6-tetrafluoro-4-hydroxyphenyl)methanone;ethane;sulfane (PubChem CID 159975613) has the molecular formula C21H25F4NO2S and a molecular weight of 431.50 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-(2,3,5,6-tetrafluoro-4-hydroxyphenyl)methanone;ethane;sulfane.
| Compound Name | (4-benzylpiperidin-1-yl)-(2,3,5,6-tetrafluoro-4-hydroxyphenyl)methanone;ethane;sulfane |
|---|---|
| PubChem CID | 159975613 |
| Molecular Formula | C21H25F4NO2S |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-(2,3,5,6-tetrafluoro-4-hydroxyphenyl)methanone;ethane;sulfane |
| SMILES | CC.O=C(c1c(F)c(F)c(O)c(F)c1F)N1CCC(Cc2ccccc2)CC1.S |
| InChI | InChI=1S/C19H17F4NO2.C2H6.H2S/c20-14-13(15(21)17(23)18(25)16(14)22)19(26)24-8-6-12(7-9-24)10-11-4-2-1-3-5-11;1-2;/h1-5,12,25H,6-10H2;1-2H3;1H2 |
| InChIKey | OFCQEBRLPFYRPQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|