C24H34N2O2S — CID 110826840
4-(4-benzylpiperidin-1-yl)sulfonyl-N-hexylaniline (PubChem CID 110826840) has the molecular formula C24H34N2O2S and a molecular weight of 414.62 g/mol. Its IUPAC name is 4-(4-benzylpiperidin-1-yl)sulfonyl-N-hexylaniline.
| Compound Name | 4-(4-benzylpiperidin-1-yl)sulfonyl-N-hexylaniline |
|---|---|
| PubChem CID | 110826840 |
| Molecular Formula | C24H34N2O2S |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 4-(4-benzylpiperidin-1-yl)sulfonyl-N-hexylaniline |
| SMILES | CCCCCCNc1ccc(S(=O)(=O)N2CCC(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H34N2O2S/c1-2-3-4-8-17-25-23-11-13-24(14-12-23)29(27,28)26-18-15-22(16-19-26)20-21-9-6-5-7-10-21/h5-7,9-14,22,25H,2-4,8,15-20H2,1H3 |
| InChIKey | BRPRLTYKZAHPKA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|