C26H27ClN2O3S — CID 110825251
2-[4-(4-benzylpiperidin-1-yl)sulfonylanilino]-1-(4-chlorophenyl)ethanone (PubChem CID 110825251) has the molecular formula C26H27ClN2O3S and a molecular weight of 483.03 g/mol. Its IUPAC name is 2-[4-(4-benzylpiperidin-1-yl)sulfonylanilino]-1-(4-chlorophenyl)ethanone.
| Compound Name | 2-[4-(4-benzylpiperidin-1-yl)sulfonylanilino]-1-(4-chlorophenyl)ethanone |
|---|---|
| PubChem CID | 110825251 |
| Molecular Formula | C26H27ClN2O3S |
| Molecular Weight | 483.03 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 2-[4-(4-benzylpiperidin-1-yl)sulfonylanilino]-1-(4-chlorophenyl)ethanone |
| SMILES | O=C(CNc1ccc(S(=O)(=O)N2CCC(Cc3ccccc3)CC2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H27ClN2O3S/c27-23-8-6-22(7-9-23)26(30)19-28-24-10-12-25(13-11-24)33(31,32)29-16-14-21(15-17-29)18-20-4-2-1-3-5-20/h1-13,21,28H,14-19H2 |
| InChIKey | AGHPCXSWUUEIFO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.03 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |