C26H35N3O5S2 — CID 110828288
2-[4-(azepan-1-ylsulfonyl)anilino]-1-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]ethanone (PubChem CID 110828288) has the molecular formula C26H35N3O5S2 and a molecular weight of 533.72 g/mol. Its IUPAC name is 2-[4-(azepan-1-ylsulfonyl)anilino]-1-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]ethanone.
| Compound Name | 2-[4-(azepan-1-ylsulfonyl)anilino]-1-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 110828288 |
| Molecular Formula | C26H35N3O5S2 |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | 2-[4-(azepan-1-ylsulfonyl)anilino]-1-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]ethanone |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(C(=O)CNc3ccc(S(=O)(=O)N4CCCCCC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C26H35N3O5S2/c1-21-14-18-29(19-15-21)36(33,34)24-10-6-22(7-11-24)26(30)20-27-23-8-12-25(13-9-23)35(31,32)28-16-4-2-3-5-17-28/h6-13,21,27H,2-5,14-20H2,1H3 |
| InChIKey | ANPJPBXSUGMWER-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |