C20H24N2O4S — CID 110824089
2-(4-methoxyanilino)-1-(4-piperidin-1-ylsulfonylphenyl)ethanone (PubChem CID 110824089) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 2-(4-methoxyanilino)-1-(4-piperidin-1-ylsulfonylphenyl)ethanone.
| Compound Name | 2-(4-methoxyanilino)-1-(4-piperidin-1-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 110824089 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-(4-methoxyanilino)-1-(4-piperidin-1-ylsulfonylphenyl)ethanone |
| SMILES | COc1ccc(NCC(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O4S/c1-26-18-9-7-17(8-10-18)21-15-20(23)16-5-11-19(12-6-16)27(24,25)22-13-3-2-4-14-22/h5-12,21H,2-4,13-15H2,1H3 |
| InChIKey | HRCQIBIITSDKCU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|