C19H21ClN2O4S — CID 110824050
2-(3-chloro-4-methoxyanilino)-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethanone (PubChem CID 110824050) has the molecular formula C19H21ClN2O4S and a molecular weight of 408.91 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyanilino)-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethanone.
| Compound Name | 2-(3-chloro-4-methoxyanilino)-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 110824050 |
| Molecular Formula | C19H21ClN2O4S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 2-(3-chloro-4-methoxyanilino)-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethanone |
| SMILES | COc1ccc(NCC(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)cc1Cl |
| InChI | InChI=1S/C19H21ClN2O4S/c1-26-19-9-6-15(12-17(19)20)21-13-18(23)14-4-7-16(8-5-14)27(24,25)22-10-2-3-11-22/h4-9,12,21H,2-3,10-11,13H2,1H3 |
| InChIKey | JDNOVBNXWLCKTE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|