C30H31N3O5S — CID 3342078
N-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-4-(1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 3342078) has the molecular formula C30H31N3O5S and a molecular weight of 545.66 g/mol. Its IUPAC name is N-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-4-(1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 3342078 |
| Molecular Formula | C30H31N3O5S |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | N-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)Nc1ccc(S(=O)(=O)N2CCC(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C30H31N3O5S/c34-28(11-6-18-33-29(35)26-9-4-5-10-27(26)30(33)36)31-24-12-14-25(15-13-24)39(37,38)32-19-16-23(17-20-32)21-22-7-2-1-3-8-22/h1-5,7-10,12-15,23H,6,11,16-21H2,(H,31,34) |
| InChIKey | YVGUWACOFOMTHM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|