C25H30N4O5S — CID 29196602
4-(1,3-dioxoisoindol-2-yl)-N-[2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethyl]butanamide (PubChem CID 29196602) has the molecular formula C25H30N4O5S and a molecular weight of 498.61 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethyl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 29196602 |
| Molecular Formula | C25H30N4O5S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethyl]butanamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(CCNC(=O)CCCN3C(=O)c4ccccc4C3=O)CC2)cc1 |
| InChI | InChI=1S/C25H30N4O5S/c1-19-8-10-20(11-9-19)35(33,34)28-17-15-27(16-18-28)14-12-26-23(30)7-4-13-29-24(31)21-5-2-3-6-22(21)25(29)32/h2-3,5-6,8-11H,4,7,12-18H2,1H3,(H,26,30) |
| InChIKey | WWHVLCOBWFXFOE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|