C25H29N3O5S — CID 108759249
6-(1,3-dioxoisoindol-2-yl)-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]hexanamide (PubChem CID 108759249) has the molecular formula C25H29N3O5S and a molecular weight of 483.59 g/mol. Its IUPAC name is 6-(1,3-dioxoisoindol-2-yl)-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]hexanamide.
| Compound Name | 6-(1,3-dioxoisoindol-2-yl)-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]hexanamide |
|---|---|
| PubChem CID | 108759249 |
| Molecular Formula | C25H29N3O5S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 6-(1,3-dioxoisoindol-2-yl)-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]hexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2C1=O)NCc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C25H29N3O5S/c29-23(10-2-1-5-17-28-24(30)21-8-3-4-9-22(21)25(28)31)26-18-19-11-13-20(14-12-19)34(32,33)27-15-6-7-16-27/h3-4,8-9,11-14H,1-2,5-7,10,15-18H2,(H,26,29) |
| InChIKey | GALAPMYKLCOFQA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|