C20H27N3O4 — CID 108574012
N-[2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]ethyl]-3,3-dimethylbutanamide (PubChem CID 108574012) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is N-[2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]ethyl]-3,3-dimethylbutanamide.
| Compound Name | N-[2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]ethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 108574012 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | N-[2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]ethyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NCCNC(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H27N3O4/c1-20(2,3)13-17(25)22-11-10-21-16(24)9-6-12-23-18(26)14-7-4-5-8-15(14)19(23)27/h4-5,7-8H,6,9-13H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | AQSXYYGHGDJKMT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|