C20H20N4O4 — CID 108542672
N-[2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]ethyl]pyridine-4-carboxamide (PubChem CID 108542672) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is N-[2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]ethyl]pyridine-4-carboxamide.
| Compound Name | N-[2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 108542672 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]ethyl]pyridine-4-carboxamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)NCCNC(=O)c1ccncc1 |
| InChI | InChI=1S/C20H20N4O4/c25-17(22-11-12-23-18(26)14-7-9-21-10-8-14)6-3-13-24-19(27)15-4-1-2-5-16(15)20(24)28/h1-2,4-5,7-10H,3,6,11-13H2,(H,22,25)(H,23,26) |
| InChIKey | RNDGMZGHWKFUIS-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|