C16H13F5N2O2S — CID 138529969
1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-4-phenylpiperazine (PubChem CID 138529969) has the molecular formula C16H13F5N2O2S and a molecular weight of 392.35 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-4-phenylpiperazine.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-4-phenylpiperazine |
|---|---|
| PubChem CID | 138529969 |
| Molecular Formula | C16H13F5N2O2S |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-4-phenylpiperazine |
| SMILES | O=S(=O)(c1c(F)c(F)c(F)c(F)c1F)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C16H13F5N2O2S/c17-11-12(18)14(20)16(15(21)13(11)19)26(24,25)23-8-6-22(7-9-23)10-4-2-1-3-5-10/h1-5H,6-9H2 |
| InChIKey | FUXQGUVSACAFJN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|