C20H16F5N3O2S2 — CID 87466555
4-benzyl-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperazin-1-yl]-1,3-thiazole (PubChem CID 87466555) has the molecular formula C20H16F5N3O2S2 and a molecular weight of 489.49 g/mol. Its IUPAC name is 4-benzyl-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperazin-1-yl]-1,3-thiazole.
| Compound Name | 4-benzyl-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 87466555 |
| Molecular Formula | C20H16F5N3O2S2 |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | 4-benzyl-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperazin-1-yl]-1,3-thiazole |
| SMILES | O=S(=O)(c1c(F)c(F)c(F)c(F)c1F)N1CCN(c2nc(Cc3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C20H16F5N3O2S2/c21-14-15(22)17(24)19(18(25)16(14)23)32(29,30)28-8-6-27(7-9-28)20-26-13(11-31-20)10-12-4-2-1-3-5-12/h1-5,11H,6-10H2 |
| InChIKey | GDLACXOZVXSDJR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|