C22H20F5N3O2S2 — CID 87465276
2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperazin-1-yl]-4-(2,4,6-trimethylphenyl)-1,3-thiazole (PubChem CID 87465276) has the molecular formula C22H20F5N3O2S2 and a molecular weight of 517.55 g/mol. Its IUPAC name is 2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperazin-1-yl]-4-(2,4,6-trimethylphenyl)-1,3-thiazole.
| Compound Name | 2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperazin-1-yl]-4-(2,4,6-trimethylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 87465276 |
| Molecular Formula | C22H20F5N3O2S2 |
| Molecular Weight | 517.55 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperazin-1-yl]-4-(2,4,6-trimethylphenyl)-1,3-thiazole |
| SMILES | Cc1cc(C)c(-c2csc(N3CCN(S(=O)(=O)c4c(F)c(F)c(F)c(F)c4F)CC3)n2)c(C)c1 |
| InChI | InChI=1S/C22H20F5N3O2S2/c1-11-8-12(2)15(13(3)9-11)14-10-33-22(28-14)29-4-6-30(7-5-29)34(31,32)21-19(26)17(24)16(23)18(25)20(21)27/h8-10H,4-7H2,1-3H3 |
| InChIKey | DSLBTHPOFMVCLC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.55 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|