C14H18N4O3S — CID 56920069
5-methyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,2-oxazol-3-amine (PubChem CID 56920069) has the molecular formula C14H18N4O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is 5-methyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,2-oxazol-3-amine.
| Compound Name | 5-methyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 56920069 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 5-methyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,2-oxazol-3-amine |
| SMILES | Cc1onc(N)c1S(=O)(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C14H18N4O3S/c1-11-13(14(15)16-21-11)22(19,20)18-9-7-17(8-10-18)12-5-3-2-4-6-12/h2-6H,7-10H2,1H3,(H2,15,16) |
| InChIKey | ORAWNFDVKLDBDD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |