C17H23N3O3S — CID 75461716
3,5-dimethyl-4-[[4-(4-methylphenyl)-1,4-diazepan-1-yl]sulfonyl]-1,2-oxazole (PubChem CID 75461716) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 3,5-dimethyl-4-[[4-(4-methylphenyl)-1,4-diazepan-1-yl]sulfonyl]-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-[[4-(4-methylphenyl)-1,4-diazepan-1-yl]sulfonyl]-1,2-oxazole |
|---|---|
| PubChem CID | 75461716 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 3,5-dimethyl-4-[[4-(4-methylphenyl)-1,4-diazepan-1-yl]sulfonyl]-1,2-oxazole |
| SMILES | Cc1ccc(N2CCCN(S(=O)(=O)c3c(C)noc3C)CC2)cc1 |
| InChI | InChI=1S/C17H23N3O3S/c1-13-5-7-16(8-6-13)19-9-4-10-20(12-11-19)24(21,22)17-14(2)18-23-15(17)3/h5-8H,4,9-12H2,1-3H3 |
| InChIKey | LATBZEJAPLGTRZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|