C18H25N3O4S — CID 113077780
3,5-dimethyl-4-[4-(4-propan-2-yloxyphenyl)piperazin-1-yl]sulfonyl-1,2-oxazole (PubChem CID 113077780) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is 3,5-dimethyl-4-[4-(4-propan-2-yloxyphenyl)piperazin-1-yl]sulfonyl-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-[4-(4-propan-2-yloxyphenyl)piperazin-1-yl]sulfonyl-1,2-oxazole |
|---|---|
| PubChem CID | 113077780 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3,5-dimethyl-4-[4-(4-propan-2-yloxyphenyl)piperazin-1-yl]sulfonyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCN(c2ccc(OC(C)C)cc2)CC1 |
| InChI | InChI=1S/C18H25N3O4S/c1-13(2)24-17-7-5-16(6-8-17)20-9-11-21(12-10-20)26(22,23)18-14(3)19-25-15(18)4/h5-8,13H,9-12H2,1-4H3 |
| InChIKey | DNMPMZOMMJXKQC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|