C16H12F5N3O2S — CID 167825185
5-cyclopropyl-2-[1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidin-3-yl]pyrimidine (PubChem CID 167825185) has the molecular formula C16H12F5N3O2S and a molecular weight of 405.35 g/mol. Its IUPAC name is 5-cyclopropyl-2-[1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidin-3-yl]pyrimidine.
| Compound Name | 5-cyclopropyl-2-[1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidin-3-yl]pyrimidine |
|---|---|
| PubChem CID | 167825185 |
| Molecular Formula | C16H12F5N3O2S |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 5-cyclopropyl-2-[1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidin-3-yl]pyrimidine |
| SMILES | O=S(=O)(c1c(F)c(F)c(F)c(F)c1F)N1CC(c2ncc(C3CC3)cn2)C1 |
| InChI | InChI=1S/C16H12F5N3O2S/c17-10-11(18)13(20)15(14(21)12(10)19)27(25,26)24-5-9(6-24)16-22-3-8(4-23-16)7-1-2-7/h3-4,7,9H,1-2,5-6H2 |
| InChIKey | QGLAIABGSJTIOS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|