C37H32ClF5N2O5S — CID 135242154
4-[(4-cyclohexylphenyl)methyl-[1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-3-carbonyl]amino]-2-phenylmethoxybenzoyl chloride (PubChem CID 135242154) has the molecular formula C37H32ClF5N2O5S and a molecular weight of 747.18 g/mol. Its IUPAC name is 4-[(4-cyclohexylphenyl)methyl-[1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-3-carbonyl]amino]-2-phenylmethoxybenzoyl chloride.
| Compound Name | 4-[(4-cyclohexylphenyl)methyl-[1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-3-carbonyl]amino]-2-phenylmethoxybenzoyl chloride |
|---|---|
| PubChem CID | 135242154 |
| Molecular Formula | C37H32ClF5N2O5S |
| Molecular Weight | 747.18 g/mol |
| Exact Mass | 746.16 |
| IUPAC Name | 4-[(4-cyclohexylphenyl)methyl-[1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-3-carbonyl]amino]-2-phenylmethoxybenzoyl chloride |
| SMILES | O=C(Cl)c1ccc(N(Cc2ccc(C3CCCCC3)cc2)C(=O)C2CN(S(=O)(=O)c3c(F)c(F)c(F)c(F)c3F)C2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C37H32ClF5N2O5S/c38-36(46)28-16-15-27(17-29(28)50-21-23-7-3-1-4-8-23)45(18-22-11-13-25(14-12-22)24-9-5-2-6-10-24)37(47)26-19-44(20-26)51(48,49)35-33(42)31(40)30(39)32(41)34(35)43/h1,3-4,7-8,11-17,24,26H,2,5-6,9-10,18-21H2 |
| InChIKey | YPKXKORTGDNNDQ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.18 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|