C35H32F4N4O6S — CID 135242312
4-[(5-cyclohexylpyrazin-2-yl)methyl-[(2R)-1-(2,3,5,6-tetrafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-phenylmethoxybenzoic acid (PubChem CID 135242312) has the molecular formula C35H32F4N4O6S and a molecular weight of 712.72 g/mol. Its IUPAC name is 4-[(5-cyclohexylpyrazin-2-yl)methyl-[(2R)-1-(2,3,5,6-tetrafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-phenylmethoxybenzoic acid.
| Compound Name | 4-[(5-cyclohexylpyrazin-2-yl)methyl-[(2R)-1-(2,3,5,6-tetrafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 135242312 |
| Molecular Formula | C35H32F4N4O6S |
| Molecular Weight | 712.72 g/mol |
| Exact Mass | 712.20 |
| IUPAC Name | 4-[(5-cyclohexylpyrazin-2-yl)methyl-[(2R)-1-(2,3,5,6-tetrafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-phenylmethoxybenzoic acid |
| SMILES | O=C(O)c1ccc(N(Cc2cnc(C3CCCCC3)cn2)C(=O)[C@H]2CCN2S(=O)(=O)c2c(F)c(F)cc(F)c2F)cc1OCc1ccccc1 |
| InChI | InChI=1S/C35H32F4N4O6S/c36-26-16-27(37)32(39)33(31(26)38)50(47,48)43-14-13-29(43)34(44)42(19-23-17-41-28(18-40-23)22-9-5-2-6-10-22)24-11-12-25(35(45)46)30(15-24)49-20-21-7-3-1-4-8-21/h1,3-4,7-8,11-12,15-18,22,29H,2,5-6,9-10,13-14,19-20H2,(H,45,46)/t29-/m1/s1 |
| InChIKey | UEAILQDSNKTJDT-GDLZYMKVSA-N |
| XLogP | 6.35 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.72 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|