C36H31F5N4O4S — CID 165153011
N-(4-cyano-3-phenylmethoxyphenyl)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide (PubChem CID 165153011) has the molecular formula C36H31F5N4O4S and a molecular weight of 710.73 g/mol. Its IUPAC name is N-(4-cyano-3-phenylmethoxyphenyl)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide.
| Compound Name | N-(4-cyano-3-phenylmethoxyphenyl)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 165153011 |
| Molecular Formula | C36H31F5N4O4S |
| Molecular Weight | 710.73 g/mol |
| Exact Mass | 710.20 |
| IUPAC Name | N-(4-cyano-3-phenylmethoxyphenyl)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
| SMILES | N#Cc1ccc(N(Cc2ccc(C3CCCCC3)cn2)C(=O)C2CCN2S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1OCc1ccccc1 |
| InChI | InChI=1S/C36H31F5N4O4S/c37-30-31(38)33(40)35(34(41)32(30)39)50(47,48)45-16-15-28(45)36(46)44(20-26-13-11-25(19-43-26)23-9-5-2-6-10-23)27-14-12-24(18-42)29(17-27)49-21-22-7-3-1-4-8-22/h1,3-4,7-8,11-14,17,19,23,28H,2,5-6,9-10,15-16,20-21H2 |
| InChIKey | GKUZGPYGIQOIJP-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 103.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.73 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|