C30H29F5N4O4S — CID 142404592
(2R)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-(1-hydroxy-2,3-dihydro-1H-isoindol-5-yl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide (PubChem CID 142404592) has the molecular formula C30H29F5N4O4S and a molecular weight of 636.64 g/mol. Its IUPAC name is (2R)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-(1-hydroxy-2,3-dihydro-1H-isoindol-5-yl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide.
| Compound Name | (2R)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-(1-hydroxy-2,3-dihydro-1H-isoindol-5-yl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 142404592 |
| Molecular Formula | C30H29F5N4O4S |
| Molecular Weight | 636.64 g/mol |
| Exact Mass | 636.18 |
| IUPAC Name | (2R)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-(1-hydroxy-2,3-dihydro-1H-isoindol-5-yl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
| SMILES | O=C([C@H]1CCN1S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F)N(Cc1ccc(C2CCCCC2)cn1)c1ccc2c(c1)CNC2O |
| InChI | InChI=1S/C30H29F5N4O4S/c31-23-24(32)26(34)28(27(35)25(23)33)44(42,43)39-11-10-22(39)30(41)38(20-8-9-21-18(12-20)14-37-29(21)40)15-19-7-6-17(13-36-19)16-4-2-1-3-5-16/h6-9,12-13,16,22,29,37,40H,1-5,10-11,14-15H2/t22-,29?/m1/s1 |
| InChIKey | BCNGPPQVCDBUNM-DMDVIOLWSA-N |
| XLogP | 4.92 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|