C30H26F5N5O4S — CID 165152842
N-[(4-cyclohexyl-2-pyridinyl)methyl]-N-(1-oxo-2H-phthalazin-6-yl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide (PubChem CID 165152842) has the molecular formula C30H26F5N5O4S and a molecular weight of 647.63 g/mol. Its IUPAC name is N-[(4-cyclohexyl-2-pyridinyl)methyl]-N-(1-oxo-2H-phthalazin-6-yl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide.
| Compound Name | N-[(4-cyclohexyl-2-pyridinyl)methyl]-N-(1-oxo-2H-phthalazin-6-yl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 165152842 |
| Molecular Formula | C30H26F5N5O4S |
| Molecular Weight | 647.63 g/mol |
| Exact Mass | 647.16 |
| IUPAC Name | N-[(4-cyclohexyl-2-pyridinyl)methyl]-N-(1-oxo-2H-phthalazin-6-yl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
| SMILES | O=C(C1CCN1S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F)N(Cc1cc(C2CCCCC2)ccn1)c1ccc2c(=O)[nH]ncc2c1 |
| InChI | InChI=1S/C30H26F5N5O4S/c31-23-24(32)26(34)28(27(35)25(23)33)45(43,44)40-11-9-22(40)30(42)39(20-6-7-21-18(13-20)14-37-38-29(21)41)15-19-12-17(8-10-36-19)16-4-2-1-3-5-16/h6-8,10,12-14,16,22H,1-5,9,11,15H2,(H,38,41) |
| InChIKey | AVUQNMOLMYSIEN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|