C31H21F6N5O4S — CID 165152944
N-[[5-(4-fluorophenyl)-2-pyridinyl]methyl]-N-(2-methyl-1-oxophthalazin-6-yl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide (PubChem CID 165152944) has the molecular formula C31H21F6N5O4S and a molecular weight of 673.60 g/mol. Its IUPAC name is N-[[5-(4-fluorophenyl)-2-pyridinyl]methyl]-N-(2-methyl-1-oxophthalazin-6-yl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide.
| Compound Name | N-[[5-(4-fluorophenyl)-2-pyridinyl]methyl]-N-(2-methyl-1-oxophthalazin-6-yl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 165152944 |
| Molecular Formula | C31H21F6N5O4S |
| Molecular Weight | 673.60 g/mol |
| Exact Mass | 673.12 |
| IUPAC Name | N-[[5-(4-fluorophenyl)-2-pyridinyl]methyl]-N-(2-methyl-1-oxophthalazin-6-yl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
| SMILES | Cn1ncc2cc(N(Cc3ccc(-c4ccc(F)cc4)cn3)C(=O)C3CCN3S(=O)(=O)c3c(F)c(F)c(F)c(F)c3F)ccc2c1=O |
| InChI | InChI=1S/C31H21F6N5O4S/c1-40-30(43)22-9-8-21(12-18(22)14-39-40)41(15-20-7-4-17(13-38-20)16-2-5-19(32)6-3-16)31(44)23-10-11-42(23)47(45,46)29-27(36)25(34)24(33)26(35)28(29)37/h2-9,12-14,23H,10-11,15H2,1H3 |
| InChIKey | OAVVRGUXVOGVBK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 105.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|