C30H26F6N4O3S — CID 153301544
N-[(4-cyclohexylphenyl)methyl]-N-(5-fluoro-1H-indazol-6-yl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide (PubChem CID 153301544) has the molecular formula C30H26F6N4O3S and a molecular weight of 636.62 g/mol. Its IUPAC name is N-[(4-cyclohexylphenyl)methyl]-N-(5-fluoro-1H-indazol-6-yl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide.
| Compound Name | N-[(4-cyclohexylphenyl)methyl]-N-(5-fluoro-1H-indazol-6-yl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 153301544 |
| Molecular Formula | C30H26F6N4O3S |
| Molecular Weight | 636.62 g/mol |
| Exact Mass | 636.16 |
| IUPAC Name | N-[(4-cyclohexylphenyl)methyl]-N-(5-fluoro-1H-indazol-6-yl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
| SMILES | O=C(C1CCN1S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F)N(Cc1ccc(C2CCCCC2)cc1)c1cc2[nH]ncc2cc1F |
| InChI | InChI=1S/C30H26F6N4O3S/c31-20-12-19-14-37-38-21(19)13-23(20)39(15-16-6-8-18(9-7-16)17-4-2-1-3-5-17)30(41)22-10-11-40(22)44(42,43)29-27(35)25(33)24(32)26(34)28(29)36/h6-9,12-14,17,22H,1-5,10-11,15H2,(H,37,38) |
| InChIKey | NTFPDUXSSJGZHV-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.62 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|