C35H31F6N5O5S — CID 135241896
N-[(5-cyclohexylpyrazin-2-yl)methyl]-N-[2-fluoro-4-(phenylmethoxycarbamoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide (PubChem CID 135241896) has the molecular formula C35H31F6N5O5S and a molecular weight of 747.72 g/mol. Its IUPAC name is N-[(5-cyclohexylpyrazin-2-yl)methyl]-N-[2-fluoro-4-(phenylmethoxycarbamoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide.
| Compound Name | N-[(5-cyclohexylpyrazin-2-yl)methyl]-N-[2-fluoro-4-(phenylmethoxycarbamoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 135241896 |
| Molecular Formula | C35H31F6N5O5S |
| Molecular Weight | 747.72 g/mol |
| Exact Mass | 747.20 |
| IUPAC Name | N-[(5-cyclohexylpyrazin-2-yl)methyl]-N-[2-fluoro-4-(phenylmethoxycarbamoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
| SMILES | O=C(NOCc1ccccc1)c1ccc(N(Cc2cnc(C3CCCCC3)cn2)C(=O)C2CCN2S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C35H31F6N5O5S/c36-24-15-22(34(47)44-51-19-20-7-3-1-4-8-20)11-12-26(24)45(18-23-16-43-25(17-42-23)21-9-5-2-6-10-21)35(48)27-13-14-46(27)52(49,50)33-31(40)29(38)28(37)30(39)32(33)41/h1,3-4,7-8,11-12,15-17,21,27H,2,5-6,9-10,13-14,18-19H2,(H,44,47) |
| InChIKey | YSRAVGRKLRKHGG-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.72 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|